C12H13N3O — CID 60671689
2-[(cyclopropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 60671689) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(cyclopropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 60671689 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CNC2CC2)nc2ccccn12 |
| InChI | InChI=1S/C12H13N3O/c16-12-7-10(8-13-9-4-5-9)14-11-3-1-2-6-15(11)12/h1-3,6-7,9,13H,4-5,8H2 |
| InChIKey | YBNXBDUJEICSCD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |