C12H15N3O — CID 60671768
2-(propylaminomethyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 60671768) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(propylaminomethyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(propylaminomethyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 60671768 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-(propylaminomethyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCCNCc1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C12H15N3O/c1-2-6-13-9-10-8-12(16)15-7-4-3-5-11(15)14-10/h3-5,7-8,13H,2,6,9H2,1H3 |
| InChIKey | HCAODDOPMKKCLQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|