C12H15N5O2 — CID 83121210
2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylamino]ethylurea (PubChem CID 83121210) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylamino]ethylurea.
| Compound Name | 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylamino]ethylurea |
|---|---|
| PubChem CID | 83121210 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)methylamino]ethylurea |
| SMILES | NC(=O)NCCNCc1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C12H15N5O2/c13-12(19)15-5-4-14-8-9-7-11(18)17-6-2-1-3-10(17)16-9/h1-3,6-7,14H,4-5,8H2,(H3,13,15,19) |
| InChIKey | SUOVALYONSDKLI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|