C13H17N3O3S — CID 62670048
2-[(3-methylsulfonylpropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 62670048) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[(3-methylsulfonylpropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(3-methylsulfonylpropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 62670048 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[(3-methylsulfonylpropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CS(=O)(=O)CCCNCc1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C13H17N3O3S/c1-20(18,19)8-4-6-14-10-11-9-13(17)16-7-3-2-5-12(16)15-11/h2-3,5,7,9,14H,4,6,8,10H2,1H3 |
| InChIKey | GCSAJZXFILTKHV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|