C15H20N4O — CID 60673235
2-[(2-pyrrolidin-1-ylethylamino)methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 60673235) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[(2-pyrrolidin-1-ylethylamino)methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(2-pyrrolidin-1-ylethylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 60673235 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[(2-pyrrolidin-1-ylethylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CNCCN2CCCC2)nc2ccccn12 |
| InChI | InChI=1S/C15H20N4O/c20-15-11-13(17-14-5-1-2-9-19(14)15)12-16-6-10-18-7-3-4-8-18/h1-2,5,9,11,16H,3-4,6-8,10,12H2 |
| InChIKey | OUONLZPTLZWLSN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|