C12H12F3N3OS — CID 106429069
2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 106429069) has the molecular formula C12H12F3N3OS and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 106429069 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CNCCSC(F)(F)F)nc2ccccn12 |
| InChI | InChI=1S/C12H12F3N3OS/c13-12(14,15)20-6-4-16-8-9-7-11(19)18-5-2-1-3-10(18)17-9/h1-3,5,7,16H,4,6,8H2 |
| InChIKey | TVDGMSSPZPFDEI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|