C11H13N3O2 — CID 60702906
2-[(ethoxyamino)methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 60702906) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[(ethoxyamino)methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(ethoxyamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 60702906 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-[(ethoxyamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCONCc1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C11H13N3O2/c1-2-16-12-8-9-7-11(15)14-6-4-3-5-10(14)13-9/h3-7,12H,2,8H2,1H3 |
| InChIKey | ZXPLGBIRTAVYEB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|