C14H15N3O — CID 106228957
2-[(pent-1-yn-3-ylamino)methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 106228957) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[(pent-1-yn-3-ylamino)methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(pent-1-yn-3-ylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 106228957 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-[(pent-1-yn-3-ylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C#CC(CC)NCc1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C14H15N3O/c1-3-11(4-2)15-10-12-9-14(18)17-8-6-5-7-13(17)16-12/h1,5-9,11,15H,4,10H2,2H3 |
| InChIKey | OXRDCGXXPUNBSX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|