C13H7Cl2N3 — CID 556140
2,6-dichloro-3-pyridin-2-ylquinoxaline (PubChem CID 556140) has the molecular formula C13H7Cl2N3 and a molecular weight of 276.13 g/mol. Its IUPAC name is 2,6-dichloro-3-pyridin-2-ylquinoxaline.
| Compound Name | 2,6-dichloro-3-pyridin-2-ylquinoxaline |
|---|---|
| PubChem CID | 556140 |
| Molecular Formula | C13H7Cl2N3 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 2,6-dichloro-3-pyridin-2-ylquinoxaline |
| SMILES | Clc1ccc2nc(Cl)c(-c3ccccn3)nc2c1 |
| InChI | InChI=1S/C13H7Cl2N3/c14-8-4-5-9-11(7-8)17-12(13(15)18-9)10-3-1-2-6-16-10/h1-7H |
| InChIKey | ZNJGREOBTLXZFY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |