C18H20ClN5 — CID 18549055
N-(6-chloro-3-pyridin-2-ylquinoxalin-2-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 18549055) has the molecular formula C18H20ClN5 and a molecular weight of 341.85 g/mol. Its IUPAC name is N-(6-chloro-3-pyridin-2-ylquinoxalin-2-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(6-chloro-3-pyridin-2-ylquinoxalin-2-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 18549055 |
| Molecular Formula | C18H20ClN5 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-(6-chloro-3-pyridin-2-ylquinoxalin-2-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc2ccc(Cl)cc2nc1-c1ccccn1 |
| InChI | InChI=1S/C18H20ClN5/c1-24(2)11-5-10-21-18-17(15-6-3-4-9-20-15)22-16-12-13(19)7-8-14(16)23-18/h3-4,6-9,12H,5,10-11H2,1-2H3,(H,21,23) |
| InChIKey | CALIZINPRFKXBG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|