C20H24Cl2N6 — CID 67640185
6-N-(6,7-dichloro-3-pyridin-2-ylquinoxalin-2-yl)-1-N-methylhexane-1,3,6-triamine (PubChem CID 67640185) has the molecular formula C20H24Cl2N6 and a molecular weight of 419.36 g/mol. Its IUPAC name is 6-N-(6,7-dichloro-3-pyridin-2-ylquinoxalin-2-yl)-1-N-methylhexane-1,3,6-triamine.
| Compound Name | 6-N-(6,7-dichloro-3-pyridin-2-ylquinoxalin-2-yl)-1-N-methylhexane-1,3,6-triamine |
|---|---|
| PubChem CID | 67640185 |
| Molecular Formula | C20H24Cl2N6 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 6-N-(6,7-dichloro-3-pyridin-2-ylquinoxalin-2-yl)-1-N-methylhexane-1,3,6-triamine |
| SMILES | CNCCC(N)CCCNc1nc2cc(Cl)c(Cl)cc2nc1-c1ccccn1 |
| InChI | InChI=1S/C20H24Cl2N6/c1-24-10-7-13(23)5-4-9-26-20-19(16-6-2-3-8-25-16)27-17-11-14(21)15(22)12-18(17)28-20/h2-3,6,8,11-13,24H,4-5,7,9-10,23H2,1H3,(H,26,28) |
| InChIKey | KHRZJILJAYDXAL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|