C20H18Cl2FN3 — CID 68578856
N-butyl-4-chloro-3-(2-chloro-6-fluorophenyl)-6-pyridin-2-ylpyridin-2-amine (PubChem CID 68578856) has the molecular formula C20H18Cl2FN3 and a molecular weight of 390.29 g/mol. Its IUPAC name is N-butyl-4-chloro-3-(2-chloro-6-fluorophenyl)-6-pyridin-2-ylpyridin-2-amine.
| Compound Name | N-butyl-4-chloro-3-(2-chloro-6-fluorophenyl)-6-pyridin-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 68578856 |
| Molecular Formula | C20H18Cl2FN3 |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-butyl-4-chloro-3-(2-chloro-6-fluorophenyl)-6-pyridin-2-ylpyridin-2-amine |
| SMILES | CCCCNc1nc(-c2ccccn2)cc(Cl)c1-c1c(F)cccc1Cl |
| InChI | InChI=1S/C20H18Cl2FN3/c1-2-3-10-25-20-19(18-13(21)7-6-8-15(18)23)14(22)12-17(26-20)16-9-4-5-11-24-16/h4-9,11-12H,2-3,10H2,1H3,(H,25,26) |
| InChIKey | DBARAKLECVIYAH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|