C17H24ClN5 — CID 6405736
N-[6-(4-chlorophenyl)-3-propan-2-yl-1,2,4-triazin-5-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 6405736) has the molecular formula C17H24ClN5 and a molecular weight of 333.87 g/mol. Its IUPAC name is N-[6-(4-chlorophenyl)-3-propan-2-yl-1,2,4-triazin-5-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[6-(4-chlorophenyl)-3-propan-2-yl-1,2,4-triazin-5-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 6405736 |
| Molecular Formula | C17H24ClN5 |
| Molecular Weight | 333.87 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-[6-(4-chlorophenyl)-3-propan-2-yl-1,2,4-triazin-5-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC(C)c1nnc(-c2ccc(Cl)cc2)c(NCCCN(C)C)n1 |
| InChI | InChI=1S/C17H24ClN5/c1-12(2)16-20-17(19-10-5-11-23(3)4)15(21-22-16)13-6-8-14(18)9-7-13/h6-9,12H,5,10-11H2,1-4H3,(H,19,20,22) |
| InChIKey | IAFIEVWGHOEJCN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|