About 7-methoxy-5-methyl-1,8-naphthyridin-2-amine
7-methoxy-5-methyl-1,8-naphthyridin-2-amine (PubChem CID 14751713) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 7-methoxy-5-methyl-1,8-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 7-methoxy-5-methyl-1,8-naphthyridin-2-amine |
| PubChem CID | 14751713 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 7-methoxy-5-methyl-1,8-naphthyridin-2-amine |
| SMILES | COc1cc(C)c2ccc(N)nc2n1 |
| InChI | InChI=1S/C10H11N3O/c1-6-5-9(14-2)13-10-7(6)3-4-8(11)12-10/h3-5H,1-2H3,(H2,11,12,13) |
| InChIKey | QYUUZYJPUVNIMG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methoxy-5-methyl-1,8-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-5-methyl-1,8-naphthyridin-2-amine?
The IUPAC name of 7-methoxy-5-methyl-1,8-naphthyridin-2-amine (CID 14751713) is 7-methoxy-5-methyl-1,8-naphthyridin-2-amine.
What is the SMILES notation for 7-methoxy-5-methyl-1,8-naphthyridin-2-amine?
The canonical SMILES for 7-methoxy-5-methyl-1,8-naphthyridin-2-amine is COc1cc(C)c2ccc(N)nc2n1.
What is the InChIKey of 7-methoxy-5-methyl-1,8-naphthyridin-2-amine?
The InChIKey is QYUUZYJPUVNIMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-6-5-9(14-2)13-10-7(6)3-4-8(11)12-10/h3-5H,1-2H3,(H2,11,12,13).
What are the key properties of 7-methoxy-5-methyl-1,8-naphthyridin-2-amine?
7-methoxy-5-methyl-1,8-naphthyridin-2-amine has a molecular weight of 189.22 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-5-methyl-1,8-naphthyridin-2-amine is sourced from PubChem (CID 14751713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).