C19H20N2O — CID 159911146
5,7-dimethyl-2-[(2-methylanilino)methyl]quinolin-8-ol (PubChem CID 159911146) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 5,7-dimethyl-2-[(2-methylanilino)methyl]quinolin-8-ol.
| Compound Name | 5,7-dimethyl-2-[(2-methylanilino)methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 159911146 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 5,7-dimethyl-2-[(2-methylanilino)methyl]quinolin-8-ol |
| SMILES | Cc1ccccc1NCc1ccc2c(C)cc(C)c(O)c2n1 |
| InChI | InChI=1S/C19H20N2O/c1-12-6-4-5-7-17(12)20-11-15-8-9-16-13(2)10-14(3)19(22)18(16)21-15/h4-10,20,22H,11H2,1-3H3 |
| InChIKey | VHDDORHRJWKQTJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |