C26H20N2O2Pt — CID 135975765
2-[9-(2-hydroxyphenyl)-4,7-dimethyl-1,10-phenanthrolin-2-yl]phenol;platinum (PubChem CID 135975765) has the molecular formula C26H20N2O2Pt and a molecular weight of 587.54 g/mol. Its IUPAC name is 2-[9-(2-hydroxyphenyl)-4,7-dimethyl-1,10-phenanthrolin-2-yl]phenol;platinum.
| Compound Name | 2-[9-(2-hydroxyphenyl)-4,7-dimethyl-1,10-phenanthrolin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 135975765 |
| Molecular Formula | C26H20N2O2Pt |
| Molecular Weight | 587.54 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | 2-[9-(2-hydroxyphenyl)-4,7-dimethyl-1,10-phenanthrolin-2-yl]phenol;platinum |
| SMILES | Cc1cc(-c2ccccc2O)nc2c1ccc1c(C)cc(-c3ccccc3O)nc12.[Pt] |
| InChI | InChI=1S/C26H20N2O2.Pt/c1-15-13-21(19-7-3-5-9-23(19)29)27-25-17(15)11-12-18-16(2)14-22(28-26(18)25)20-8-4-6-10-24(20)30;/h3-14,29-30H,1-2H3; |
| InChIKey | KXEGPXYTWOPLNU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|