C44H28N2O2PtS2 — CID 135975702
3-[9-(2-hydroxy-5-phenylthiophen-3-yl)-4,7-diphenyl-1,10-phenanthrolin-2-yl]-5-phenylthiophen-2-ol;platinum (PubChem CID 135975702) has the molecular formula C44H28N2O2PtS2 and a molecular weight of 875.93 g/mol. Its IUPAC name is 3-[9-(2-hydroxy-5-phenylthiophen-3-yl)-4,7-diphenyl-1,10-phenanthrolin-2-yl]-5-phenylthiophen-2-ol;platinum.
| Compound Name | 3-[9-(2-hydroxy-5-phenylthiophen-3-yl)-4,7-diphenyl-1,10-phenanthrolin-2-yl]-5-phenylthiophen-2-ol;platinum |
|---|---|
| PubChem CID | 135975702 |
| Molecular Formula | C44H28N2O2PtS2 |
| Molecular Weight | 875.93 g/mol |
| Exact Mass | 875.12 |
| IUPAC Name | 3-[9-(2-hydroxy-5-phenylthiophen-3-yl)-4,7-diphenyl-1,10-phenanthrolin-2-yl]-5-phenylthiophen-2-ol;platinum |
| SMILES | Oc1sc(-c2ccccc2)cc1-c1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)cc(-c4cc(-c5ccccc5)sc4O)nc3c2n1.[Pt] |
| InChI | InChI=1S/C44H28N2O2S2.Pt/c47-43-35(25-39(49-43)29-17-9-3-10-18-29)37-23-33(27-13-5-1-6-14-27)31-21-22-32-34(28-15-7-2-8-16-28)24-38(46-42(32)41(31)45-37)36-26-40(50-44(36)48)30-19-11-4-12-20-30;/h1-26,47-48H; |
| InChIKey | ADGHFMUDJFSSHB-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.93 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|