C20H21NO2 — CID 169420711
[2-(2-ethoxyphenyl)-4,8-dimethylquinolin-7-yl]methanol (PubChem CID 169420711) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is [2-(2-ethoxyphenyl)-4,8-dimethylquinolin-7-yl]methanol.
| Compound Name | [2-(2-ethoxyphenyl)-4,8-dimethylquinolin-7-yl]methanol |
|---|---|
| PubChem CID | 169420711 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [2-(2-ethoxyphenyl)-4,8-dimethylquinolin-7-yl]methanol |
| SMILES | CCOc1ccccc1-c1cc(C)c2ccc(CO)c(C)c2n1 |
| InChI | InChI=1S/C20H21NO2/c1-4-23-19-8-6-5-7-17(19)18-11-13(2)16-10-9-15(12-22)14(3)20(16)21-18/h5-11,22H,4,12H2,1-3H3 |
| InChIKey | AXDHOCOSNXNKLX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |