C20H20ClNO3 — CID 169410865
[2-(2-chloro-4,5-dimethoxyphenyl)-4,8-dimethylquinolin-7-yl]methanol (PubChem CID 169410865) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is [2-(2-chloro-4,5-dimethoxyphenyl)-4,8-dimethylquinolin-7-yl]methanol.
| Compound Name | [2-(2-chloro-4,5-dimethoxyphenyl)-4,8-dimethylquinolin-7-yl]methanol |
|---|---|
| PubChem CID | 169410865 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | [2-(2-chloro-4,5-dimethoxyphenyl)-4,8-dimethylquinolin-7-yl]methanol |
| SMILES | COc1cc(Cl)c(-c2cc(C)c3ccc(CO)c(C)c3n2)cc1OC |
| InChI | InChI=1S/C20H20ClNO3/c1-11-7-17(15-8-18(24-3)19(25-4)9-16(15)21)22-20-12(2)13(10-23)5-6-14(11)20/h5-9,23H,10H2,1-4H3 |
| InChIKey | KTTLJCYQVBSJLX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |