C9H11ClO3 — CID 84671127
(4-chloro-2,3-dimethoxyphenyl)methanol (PubChem CID 84671127) has the molecular formula C9H11ClO3 and a molecular weight of 202.64 g/mol. Its IUPAC name is (4-chloro-2,3-dimethoxyphenyl)methanol.
| Compound Name | (4-chloro-2,3-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 84671127 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | (4-chloro-2,3-dimethoxyphenyl)methanol |
| SMILES | COc1c(Cl)ccc(CO)c1OC |
| InChI | InChI=1S/C9H11ClO3/c1-12-8-6(5-11)3-4-7(10)9(8)13-2/h3-4,11H,5H2,1-2H3 |
| InChIKey | WFJFTWBMJGHYPW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |