C11H10ClNO3 — CID 175903658
3-(2-chloro-4,5-dimethoxyphenyl)-5-deuterio-1,2-oxazole (PubChem CID 175903658) has the molecular formula C11H10ClNO3 and a molecular weight of 240.66 g/mol. Its IUPAC name is 3-(2-chloro-4,5-dimethoxyphenyl)-5-deuterio-1,2-oxazole.
| Compound Name | 3-(2-chloro-4,5-dimethoxyphenyl)-5-deuterio-1,2-oxazole |
|---|---|
| PubChem CID | 175903658 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 240.66 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 3-(2-chloro-4,5-dimethoxyphenyl)-5-deuterio-1,2-oxazole |
| SMILES | [2H]c1cc(-c2cc(OC)c(OC)cc2Cl)no1 |
| InChI | InChI=1S/C11H10ClNO3/c1-14-10-5-7(9-3-4-16-13-9)8(12)6-11(10)15-2/h3-6H,1-2H3/i4D |
| InChIKey | TXVJNDFRXAQVDX-QYKNYGDISA-N |
| XLogP | 3.01 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |