C11H12ClN3O2 — CID 117387074
4-(4-chloro-2,5-dimethoxyphenyl)-1H-pyrazol-5-amine (PubChem CID 117387074) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 4-(4-chloro-2,5-dimethoxyphenyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(4-chloro-2,5-dimethoxyphenyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117387074 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 4-(4-chloro-2,5-dimethoxyphenyl)-1H-pyrazol-5-amine |
| SMILES | COc1cc(-c2cn[nH]c2N)c(OC)cc1Cl |
| InChI | InChI=1S/C11H12ClN3O2/c1-16-9-4-8(12)10(17-2)3-6(9)7-5-14-15-11(7)13/h3-5H,1-2H3,(H3,13,14,15) |
| InChIKey | SCAQJGARZKUJQJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |