C12H13F2N3O2 — CID 117426004
4-[4-(difluoromethyl)-2,5-dimethoxyphenyl]-1H-pyrazol-5-amine (PubChem CID 117426004) has the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)-2,5-dimethoxyphenyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[4-(difluoromethyl)-2,5-dimethoxyphenyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117426004 |
| Molecular Formula | C12H13F2N3O2 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-[4-(difluoromethyl)-2,5-dimethoxyphenyl]-1H-pyrazol-5-amine |
| SMILES | COc1cc(C(F)F)c(OC)cc1-c1cn[nH]c1N |
| InChI | InChI=1S/C12H13F2N3O2/c1-18-9-4-7(11(13)14)10(19-2)3-6(9)8-5-16-17-12(8)15/h3-5,11H,1-2H3,(H3,15,16,17) |
| InChIKey | ZJERRBSHZMMGRS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |