C13H16FN3O2 — CID 117416880
4-[3-(1-fluoroethyl)-4,5-dimethoxyphenyl]-1H-pyrazol-5-amine (PubChem CID 117416880) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-[3-(1-fluoroethyl)-4,5-dimethoxyphenyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[3-(1-fluoroethyl)-4,5-dimethoxyphenyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117416880 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 4-[3-(1-fluoroethyl)-4,5-dimethoxyphenyl]-1H-pyrazol-5-amine |
| SMILES | COc1cc(-c2cn[nH]c2N)cc(C(C)F)c1OC |
| InChI | InChI=1S/C13H16FN3O2/c1-7(14)9-4-8(10-6-16-17-13(10)15)5-11(18-2)12(9)19-3/h4-7H,1-3H3,(H3,15,16,17) |
| InChIKey | ZRIIPOWMPUFRIG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |