C18H18Cl2N4O4 — CID 134097390
3,6-bis(4-chloro-2,5-dimethoxyphenyl)-1,4-dihydro-1,2,4,5-tetrazine (PubChem CID 134097390) has the molecular formula C18H18Cl2N4O4 and a molecular weight of 425.27 g/mol. Its IUPAC name is 3,6-bis(4-chloro-2,5-dimethoxyphenyl)-1,4-dihydro-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(4-chloro-2,5-dimethoxyphenyl)-1,4-dihydro-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 134097390 |
| Molecular Formula | C18H18Cl2N4O4 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 3,6-bis(4-chloro-2,5-dimethoxyphenyl)-1,4-dihydro-1,2,4,5-tetrazine |
| SMILES | COc1cc(C2=NNC(c3cc(OC)c(Cl)cc3OC)=NN2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N4O4/c1-25-13-7-11(19)15(27-3)5-9(13)17-21-23-18(24-22-17)10-6-16(28-4)12(20)8-14(10)26-2/h5-8H,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | XZYKLIOSRUNJQC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |