C12H10ClNO4 — CID 54189062
3-(4-chloro-2,5-dimethoxyphenyl)pyrrole-2,5-dione (PubChem CID 54189062) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is 3-(4-chloro-2,5-dimethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chloro-2,5-dimethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 54189062 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3-(4-chloro-2,5-dimethoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1cc(C2=CC(=O)NC2=O)c(OC)cc1Cl |
| InChI | InChI=1S/C12H10ClNO4/c1-17-9-5-8(13)10(18-2)3-6(9)7-4-11(15)14-12(7)16/h3-5H,1-2H3,(H,14,15,16) |
| InChIKey | PHFFJRYPINYUEA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|