About (4-chloro-2,5-dimethoxyphenyl) acetate
(4-chloro-2,5-dimethoxyphenyl) acetate (PubChem CID 165356212) has the molecular formula C10H11ClO4
and a molecular weight of 230.65 g/mol. Its IUPAC name is (4-chloro-2,5-dimethoxyphenyl) acetate.
Molecular Properties
| Compound Name | (4-chloro-2,5-dimethoxyphenyl) acetate |
| PubChem CID | 165356212 |
| Molecular Formula | C10H11ClO4 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | (4-chloro-2,5-dimethoxyphenyl) acetate |
| SMILES | COc1cc(OC(C)=O)c(OC)cc1Cl |
| InChI | InChI=1S/C10H11ClO4/c1-6(12)15-10-5-8(13-2)7(11)4-9(10)14-3/h4-5H,1-3H3 |
| InChIKey | FEKFABYKFGSFCU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2,5-dimethoxyphenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2,5-dimethoxyphenyl) acetate?
The IUPAC name of (4-chloro-2,5-dimethoxyphenyl) acetate (CID 165356212) is (4-chloro-2,5-dimethoxyphenyl) acetate.
What is the SMILES notation for (4-chloro-2,5-dimethoxyphenyl) acetate?
The canonical SMILES for (4-chloro-2,5-dimethoxyphenyl) acetate is COc1cc(OC(C)=O)c(OC)cc1Cl.
What is the InChIKey of (4-chloro-2,5-dimethoxyphenyl) acetate?
The InChIKey is FEKFABYKFGSFCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO4/c1-6(12)15-10-5-8(13-2)7(11)4-9(10)14-3/h4-5H,1-3H3.
What are the key properties of (4-chloro-2,5-dimethoxyphenyl) acetate?
(4-chloro-2,5-dimethoxyphenyl) acetate has a molecular weight of 230.65 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2,5-dimethoxyphenyl) acetate is sourced from PubChem (CID 165356212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).