About (5-bromo-2,4-dichlorophenyl) acetate
(5-bromo-2,4-dichlorophenyl) acetate (PubChem CID 70269521) has the molecular formula C8H5BrCl2O2
and a molecular weight of 283.94 g/mol. Its IUPAC name is (5-bromo-2,4-dichlorophenyl) acetate.
Molecular Properties
| Compound Name | (5-bromo-2,4-dichlorophenyl) acetate |
| PubChem CID | 70269521 |
| Molecular Formula | C8H5BrCl2O2 |
| Molecular Weight | 283.94 g/mol |
| Exact Mass | 281.88 |
| IUPAC Name | (5-bromo-2,4-dichlorophenyl) acetate |
| SMILES | CC(=O)Oc1cc(Br)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H5BrCl2O2/c1-4(12)13-8-2-5(9)6(10)3-7(8)11/h2-3H,1H3 |
| InChIKey | MNMCLFXMDKNCMN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.94 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-2,4-dichlorophenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2,4-dichlorophenyl) acetate?
The IUPAC name of (5-bromo-2,4-dichlorophenyl) acetate (CID 70269521) is (5-bromo-2,4-dichlorophenyl) acetate.
What is the SMILES notation for (5-bromo-2,4-dichlorophenyl) acetate?
The canonical SMILES for (5-bromo-2,4-dichlorophenyl) acetate is CC(=O)Oc1cc(Br)c(Cl)cc1Cl.
What is the InChIKey of (5-bromo-2,4-dichlorophenyl) acetate?
The InChIKey is MNMCLFXMDKNCMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrCl2O2/c1-4(12)13-8-2-5(9)6(10)3-7(8)11/h2-3H,1H3.
What are the key properties of (5-bromo-2,4-dichlorophenyl) acetate?
(5-bromo-2,4-dichlorophenyl) acetate has a molecular weight of 283.94 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2,4-dichlorophenyl) acetate is sourced from PubChem (CID 70269521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).