About (2-chloro-5-ethylphenyl) acetate
(2-chloro-5-ethylphenyl) acetate (PubChem CID 142057542) has the molecular formula C10H11ClO2
and a molecular weight of 198.65 g/mol. Its IUPAC name is (2-chloro-5-ethylphenyl) acetate.
Molecular Properties
| Compound Name | (2-chloro-5-ethylphenyl) acetate |
| PubChem CID | 142057542 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (2-chloro-5-ethylphenyl) acetate |
| SMILES | CCc1ccc(Cl)c(OC(C)=O)c1 |
| InChI | InChI=1S/C10H11ClO2/c1-3-8-4-5-9(11)10(6-8)13-7(2)12/h4-6H,3H2,1-2H3 |
| InChIKey | PSOZOSNPKXGWMC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-5-ethylphenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-5-ethylphenyl) acetate?
The IUPAC name of (2-chloro-5-ethylphenyl) acetate (CID 142057542) is (2-chloro-5-ethylphenyl) acetate.
What is the SMILES notation for (2-chloro-5-ethylphenyl) acetate?
The canonical SMILES for (2-chloro-5-ethylphenyl) acetate is CCc1ccc(Cl)c(OC(C)=O)c1.
What is the InChIKey of (2-chloro-5-ethylphenyl) acetate?
The InChIKey is PSOZOSNPKXGWMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2/c1-3-8-4-5-9(11)10(6-8)13-7(2)12/h4-6H,3H2,1-2H3.
What are the key properties of (2-chloro-5-ethylphenyl) acetate?
(2-chloro-5-ethylphenyl) acetate has a molecular weight of 198.65 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-5-ethylphenyl) acetate is sourced from PubChem (CID 142057542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).