C12H15NO5 — CID 102408596
(2-acetamido-4,5-dimethoxyphenyl) acetate (PubChem CID 102408596) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is (2-acetamido-4,5-dimethoxyphenyl) acetate.
| Compound Name | (2-acetamido-4,5-dimethoxyphenyl) acetate |
|---|---|
| PubChem CID | 102408596 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (2-acetamido-4,5-dimethoxyphenyl) acetate |
| SMILES | COc1cc(NC(C)=O)c(OC(C)=O)cc1OC |
| InChI | InChI=1S/C12H15NO5/c1-7(14)13-9-5-11(16-3)12(17-4)6-10(9)18-8(2)15/h5-6H,1-4H3,(H,13,14) |
| InChIKey | PBNXFQDYHHDYFN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|