C10H12BrNO4 — CID 115193326
N-(2,4,5-trimethoxyphenyl)carbamoyl bromide (PubChem CID 115193326) has the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. Its IUPAC name is N-(2,4,5-trimethoxyphenyl)carbamoyl bromide.
| Compound Name | N-(2,4,5-trimethoxyphenyl)carbamoyl bromide |
|---|---|
| PubChem CID | 115193326 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | N-(2,4,5-trimethoxyphenyl)carbamoyl bromide |
| SMILES | COc1cc(OC)c(OC)cc1NC(=O)Br |
| InChI | InChI=1S/C10H12BrNO4/c1-14-7-5-9(16-3)8(15-2)4-6(7)12-10(11)13/h4-5H,1-3H3,(H,12,13) |
| InChIKey | RADRIBYGLLMWNZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|