C14H22N2O5 — CID 120593617
4-amino-3-methoxy-N-(2,4,5-trimethoxyphenyl)butanamide (PubChem CID 120593617) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-(2,4,5-trimethoxyphenyl)butanamide.
| Compound Name | 4-amino-3-methoxy-N-(2,4,5-trimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 120593617 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-amino-3-methoxy-N-(2,4,5-trimethoxyphenyl)butanamide |
| SMILES | COc1cc(OC)c(OC)cc1NC(=O)CC(CN)OC |
| InChI | InChI=1S/C14H22N2O5/c1-18-9(8-15)5-14(17)16-10-6-12(20-3)13(21-4)7-11(10)19-2/h6-7,9H,5,8,15H2,1-4H3,(H,16,17) |
| InChIKey | XGSNXVNLGBKSAU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |