C15H24N2O5 — CID 120587250
4-amino-3-methoxy-N-[(2,4,5-trimethoxyphenyl)methyl]butanamide (PubChem CID 120587250) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[(2,4,5-trimethoxyphenyl)methyl]butanamide.
| Compound Name | 4-amino-3-methoxy-N-[(2,4,5-trimethoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 120587250 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-amino-3-methoxy-N-[(2,4,5-trimethoxyphenyl)methyl]butanamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)CC(CN)OC |
| InChI | InChI=1S/C15H24N2O5/c1-19-11(8-16)6-15(18)17-9-10-5-13(21-3)14(22-4)7-12(10)20-2/h5,7,11H,6,8-9,16H2,1-4H3,(H,17,18) |
| InChIKey | NYFIDQISTNAONH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |