C27H29NO6 — CID 27893431
[2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] 3,3-diphenylpropanoate (PubChem CID 27893431) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is [2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] 3,3-diphenylpropanoate.
| Compound Name | [2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 27893431 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [2-oxo-2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl] 3,3-diphenylpropanoate |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)COC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO6/c1-31-23-16-25(33-3)24(32-2)14-21(23)17-28-26(29)18-34-27(30)15-22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-14,16,22H,15,17-18H2,1-3H3,(H,28,29) |
| InChIKey | ZBVZYXXPALXYAW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |