C18H23ClN2O4 — CID 119690607
2-(4-aminophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide;hydrochloride (PubChem CID 119690607) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119690607 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-(4-aminophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]acetamide;hydrochloride |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)Cc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C18H22N2O4.ClH/c1-22-15-10-17(24-3)16(23-2)9-13(15)11-20-18(21)8-12-4-6-14(19)7-5-12;/h4-7,9-10H,8,11,19H2,1-3H3,(H,20,21);1H |
| InChIKey | YJVNUFWYWTXESN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|