C14H23F2NO2 — CID 178095697
N-(3,4-difluoro-5-methoxy-2-methylphenyl)acetamide;ethane (PubChem CID 178095697) has the molecular formula C14H23F2NO2 and a molecular weight of 275.34 g/mol. Its IUPAC name is N-(3,4-difluoro-5-methoxy-2-methylphenyl)acetamide;ethane.
| Compound Name | N-(3,4-difluoro-5-methoxy-2-methylphenyl)acetamide;ethane |
|---|---|
| PubChem CID | 178095697 |
| Molecular Formula | C14H23F2NO2 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-(3,4-difluoro-5-methoxy-2-methylphenyl)acetamide;ethane |
| SMILES | CC.CC.COc1cc(NC(C)=O)c(C)c(F)c1F |
| InChI | InChI=1S/C10H11F2NO2.2C2H6/c1-5-7(13-6(2)14)4-8(15-3)10(12)9(5)11;2*1-2/h4H,1-3H3,(H,13,14);2*1-2H3 |
| InChIKey | JXOICUJATWIADE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |