C8H8Cl2OS — CID 164892037
1,4-dichloro-2-methoxy-5-methylsulfanylbenzene (PubChem CID 164892037) has the molecular formula C8H8Cl2OS and a molecular weight of 223.12 g/mol. Its IUPAC name is 1,4-dichloro-2-methoxy-5-methylsulfanylbenzene.
| Compound Name | 1,4-dichloro-2-methoxy-5-methylsulfanylbenzene |
|---|---|
| PubChem CID | 164892037 |
| Molecular Formula | C8H8Cl2OS |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | 1,4-dichloro-2-methoxy-5-methylsulfanylbenzene |
| SMILES | COc1cc(Cl)c(SC)cc1Cl |
| InChI | InChI=1S/C8H8Cl2OS/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
| InChIKey | BIXRHQUIRYOLTD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |