C9H10Cl2O2S — CID 86189494
1,4-dichloro-2,5-dimethoxy-3-methylsulfanylbenzene (PubChem CID 86189494) has the molecular formula C9H10Cl2O2S and a molecular weight of 253.15 g/mol. Its IUPAC name is 1,4-dichloro-2,5-dimethoxy-3-methylsulfanylbenzene.
| Compound Name | 1,4-dichloro-2,5-dimethoxy-3-methylsulfanylbenzene |
|---|---|
| PubChem CID | 86189494 |
| Molecular Formula | C9H10Cl2O2S |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 1,4-dichloro-2,5-dimethoxy-3-methylsulfanylbenzene |
| SMILES | COc1cc(Cl)c(OC)c(SC)c1Cl |
| InChI | InChI=1S/C9H10Cl2O2S/c1-12-6-4-5(10)8(13-2)9(14-3)7(6)11/h4H,1-3H3 |
| InChIKey | WYMGMGJABKEWGC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |