C10H7Cl2NOS — CID 116868419
2-(2,5-dichloro-4-methoxyphenyl)-1,3-thiazole (PubChem CID 116868419) has the molecular formula C10H7Cl2NOS and a molecular weight of 260.15 g/mol. Its IUPAC name is 2-(2,5-dichloro-4-methoxyphenyl)-1,3-thiazole.
| Compound Name | 2-(2,5-dichloro-4-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116868419 |
| Molecular Formula | C10H7Cl2NOS |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 2-(2,5-dichloro-4-methoxyphenyl)-1,3-thiazole |
| SMILES | COc1cc(Cl)c(-c2nccs2)cc1Cl |
| InChI | InChI=1S/C10H7Cl2NOS/c1-14-9-5-7(11)6(4-8(9)12)10-13-2-3-15-10/h2-5H,1H3 |
| InChIKey | RLIGANFVHLODPH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |