C17H23BrClNO2SSi — CID 168987343
2-[4-bromo-2-chloro-5-(1,3-thiazol-2-yl)phenoxy]ethoxy-tert-butyl-dimethylsilane (PubChem CID 168987343) has the molecular formula C17H23BrClNO2SSi and a molecular weight of 448.89 g/mol. Its IUPAC name is 2-[4-bromo-2-chloro-5-(1,3-thiazol-2-yl)phenoxy]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[4-bromo-2-chloro-5-(1,3-thiazol-2-yl)phenoxy]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 168987343 |
| Molecular Formula | C17H23BrClNO2SSi |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | 2-[4-bromo-2-chloro-5-(1,3-thiazol-2-yl)phenoxy]ethoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCOc1cc(-c2nccs2)c(Br)cc1Cl |
| InChI | InChI=1S/C17H23BrClNO2SSi/c1-17(2,3)24(4,5)22-8-7-21-15-10-12(13(18)11-14(15)19)16-20-6-9-23-16/h6,9-11H,7-8H2,1-5H3 |
| InChIKey | LJAYNQOKYFUPRI-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|