C9H4Cl3NS — CID 118802426
2-(2,3,4-trichlorophenyl)-1,3-thiazole (PubChem CID 118802426) has the molecular formula C9H4Cl3NS and a molecular weight of 264.56 g/mol. Its IUPAC name is 2-(2,3,4-trichlorophenyl)-1,3-thiazole.
| Compound Name | 2-(2,3,4-trichlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 118802426 |
| Molecular Formula | C9H4Cl3NS |
| Molecular Weight | 264.56 g/mol |
| Exact Mass | 262.91 |
| IUPAC Name | 2-(2,3,4-trichlorophenyl)-1,3-thiazole |
| SMILES | Clc1ccc(-c2nccs2)c(Cl)c1Cl |
| InChI | InChI=1S/C9H4Cl3NS/c10-6-2-1-5(7(11)8(6)12)9-13-3-4-14-9/h1-4H |
| InChIKey | LFVYUNPYQXHDNV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|