C12H12ClNO2 — CID 175418289
2-(2-chloro-4,5-dimethoxyphenyl)-1H-pyrrole (PubChem CID 175418289) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 2-(2-chloro-4,5-dimethoxyphenyl)-1H-pyrrole.
| Compound Name | 2-(2-chloro-4,5-dimethoxyphenyl)-1H-pyrrole |
|---|---|
| PubChem CID | 175418289 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-(2-chloro-4,5-dimethoxyphenyl)-1H-pyrrole |
| SMILES | COc1cc(Cl)c(-c2ccc[nH]2)cc1OC |
| InChI | InChI=1S/C12H12ClNO2/c1-15-11-6-8(10-4-3-5-14-10)9(13)7-12(11)16-2/h3-7,14H,1-2H3 |
| InChIKey | BMLMNTOTOSOLQT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |