C18H17N3O — CID 123998441
2-[2-(2-amino-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol (PubChem CID 123998441) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[2-(2-amino-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol.
| Compound Name | 2-[2-(2-amino-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol |
|---|---|
| PubChem CID | 123998441 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-[2-(2-amino-3-pyridinyl)ethenyl]-5,7-dimethylquinolin-8-ol |
| SMILES | Cc1cc(C)c2ccc(C=Cc3cccnc3N)nc2c1O |
| InChI | InChI=1S/C18H17N3O/c1-11-10-12(2)17(22)16-15(11)8-7-14(21-16)6-5-13-4-3-9-20-18(13)19/h3-10,22H,1-2H3,(H2,19,20) |
| InChIKey | RUQXADZDRSPEJE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |