C7H13Cl2N3 — CID 162309877
3,6-dimethylpyridine-2,5-diamine;dihydrochloride (PubChem CID 162309877) has the molecular formula C7H13Cl2N3 and a molecular weight of 210.11 g/mol. Its IUPAC name is 3,6-dimethylpyridine-2,5-diamine;dihydrochloride.
| Compound Name | 3,6-dimethylpyridine-2,5-diamine;dihydrochloride |
|---|---|
| PubChem CID | 162309877 |
| Molecular Formula | C7H13Cl2N3 |
| Molecular Weight | 210.11 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3,6-dimethylpyridine-2,5-diamine;dihydrochloride |
| SMILES | Cc1cc(N)c(C)nc1N.Cl.Cl |
| InChI | InChI=1S/C7H11N3.2ClH/c1-4-3-6(8)5(2)10-7(4)9;;/h3H,8H2,1-2H3,(H2,9,10);2*1H |
| InChIKey | MLJNBBKODFWQKQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |