C8H13N3 — CID 4302073
3-N,5,6-trimethylpyridine-2,3-diamine (PubChem CID 4302073) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-N,5,6-trimethylpyridine-2,3-diamine.
| Compound Name | 3-N,5,6-trimethylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 4302073 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 3-N,5,6-trimethylpyridine-2,3-diamine |
| SMILES | CNc1cc(C)c(C)nc1N |
| InChI | InChI=1S/C8H13N3/c1-5-4-7(10-3)8(9)11-6(5)2/h4,10H,1-3H3,(H2,9,11) |
| InChIKey | BAGNHJHCCOWUDL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |