C8H11ClN2 — CID 79006794
2-chloro-4-N,5-dimethylbenzene-1,4-diamine (PubChem CID 79006794) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 2-chloro-4-N,5-dimethylbenzene-1,4-diamine.
| Compound Name | 2-chloro-4-N,5-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 79006794 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2-chloro-4-N,5-dimethylbenzene-1,4-diamine |
| SMILES | CNc1cc(Cl)c(N)cc1C |
| InChI | InChI=1S/C8H11ClN2/c1-5-3-7(10)6(9)4-8(5)11-2/h3-4,11H,10H2,1-2H3 |
| InChIKey | MIKXGVLROOSSTO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|