C15H25ClN2 — CID 115566164
2-chloro-5-methyl-4-N-octylbenzene-1,4-diamine (PubChem CID 115566164) has the molecular formula C15H25ClN2 and a molecular weight of 268.83 g/mol. Its IUPAC name is 2-chloro-5-methyl-4-N-octylbenzene-1,4-diamine.
| Compound Name | 2-chloro-5-methyl-4-N-octylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 115566164 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-chloro-5-methyl-4-N-octylbenzene-1,4-diamine |
| SMILES | CCCCCCCCNc1cc(Cl)c(N)cc1C |
| InChI | InChI=1S/C15H25ClN2/c1-3-4-5-6-7-8-9-18-15-11-13(16)14(17)10-12(15)2/h10-11,18H,3-9,17H2,1-2H3 |
| InChIKey | MZERMNDTTXXOMU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|