C13H21FN2 — CID 103590438
4-fluoro-1-N-hexyl-5-methylbenzene-1,2-diamine (PubChem CID 103590438) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 4-fluoro-1-N-hexyl-5-methylbenzene-1,2-diamine.
| Compound Name | 4-fluoro-1-N-hexyl-5-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 103590438 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 4-fluoro-1-N-hexyl-5-methylbenzene-1,2-diamine |
| SMILES | CCCCCCNc1cc(C)c(F)cc1N |
| InChI | InChI=1S/C13H21FN2/c1-3-4-5-6-7-16-13-8-10(2)11(14)9-12(13)15/h8-9,16H,3-7,15H2,1-2H3 |
| InChIKey | AZYOSBFEBWKRFU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|