C6H6F2N2 — CID 21132018
3,5-difluoro-6-methylpyridin-2-amine (PubChem CID 21132018) has the molecular formula C6H6F2N2 and a molecular weight of 144.12 g/mol. Its IUPAC name is 3,5-difluoro-6-methylpyridin-2-amine.
| Compound Name | 3,5-difluoro-6-methylpyridin-2-amine |
|---|---|
| PubChem CID | 21132018 |
| Molecular Formula | C6H6F2N2 |
| Molecular Weight | 144.12 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 3,5-difluoro-6-methylpyridin-2-amine |
| SMILES | Cc1nc(N)c(F)cc1F |
| InChI | InChI=1S/C6H6F2N2/c1-3-4(7)2-5(8)6(9)10-3/h2H,1H3,(H2,9,10) |
| InChIKey | XPQHRIBGJUNONE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.12 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |