C20H12ClNO2 — CID 122383206
[2-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-phenylmethanone (PubChem CID 122383206) has the molecular formula C20H12ClNO2 and a molecular weight of 333.77 g/mol. Its IUPAC name is [2-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-phenylmethanone.
| Compound Name | [2-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 122383206 |
| Molecular Formula | C20H12ClNO2 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | [2-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1-c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C20H12ClNO2/c21-14-10-11-18-17(12-14)22-20(24-18)16-9-5-4-8-15(16)19(23)13-6-2-1-3-7-13/h1-12H |
| InChIKey | IFCFHMMSLQALMP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |